12-O-Methylcarnosic acid manufacturers
|
| | 12-O-Methylcarnosic acid Basic information |
| Product Name: | 12-O-Methylcarnosic acid | | Synonyms: | 12-O-Methylcarnosic acid;12-Methoxycarnosic acid;4a(2H)-Phenanthrenecarboxylic acid, 1,3,4,9,10,10a-hexahydro-5-hydroxy-6-methoxy-1,1-dimethyl-7-(1-methylethyl)-, (4aR,10aS)-;12-Methoxycarnosic acid >=95% (LC/MS-ELSD);(4aR,10aS)-5-hydroxy-7-isopropyl-6-methoxy-1,1-dimethyl-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2H)-carboxylicaci;12 O Methylcarnosic acid,5α-reductase,Inhibitor,5 alpha Reductase,inhibit,12-Methoxycarnosic acid,12OMethylcarnosic acid;12-methylcarnosic acid;(4aR,10aS)-5-Hydroxy-7-isopropyl-6-methoxy-1,1-dimethyl-1,3,4,9,10,10a-hexahydrophenanthrene-4a(2H)-carboxylic acid | | CAS: | 62201-71-2 | | MF: | C21H30O4 | | MW: | 346.46 | | EINECS: | | | Product Categories: | | | Mol File: | 62201-71-2.mol |  |
| | 12-O-Methylcarnosic acid Chemical Properties |
| Boiling point | 505.1±50.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO : 50 mg/mL (144.32 mM; Need ultrasonic) | | form | A solid | | pka | 4.12±0.40(Predicted) | | color | White to yellow | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C21H30O4/c1-12(2)14-11-13-7-8-15-20(3,4)9-6-10-21(15,19(23)24)16(13)17(22)18(14)25-5/h11-12,15,22H,6-10H2,1-5H3,(H,23,24)/t15-,21+/m0/s1 | | InChIKey | QQNSARJGBPMQDI-YCRPNKLZSA-N | | SMILES | COc1c(O)c2c(CC[C@H]3C(C)(C)CCC[C@]23C(O)=O)cc1C(C)C |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 12-O-Methylcarnosic acid Usage And Synthesis |
| Uses | 12-O-Methylcarnosic Acid is a metabolite of Carnosic Acid (C184180), a phenolic component of rosemary. It acts as a potent antioxdant and also has UV protective activity. Specifically protection for UV-A radiation and damage. | | Biological Activity | 12-Methoxycarnosic acid is known to possess in vitro antileishmanial activity. It also functions as an antioxidant. |
| | 12-O-Methylcarnosic acid Preparation Products And Raw materials |
|