|
|
| | Vitexin -4''-O-glucoside Basic information |
| Product Name: | Vitexin -4''-O-glucoside | | Synonyms: | 4′,5,7-Trihydroxyflavone 8-C-(4?″-glucosylglucoside);8-(4-O-beta-D-Glucopyranosyl-beta-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 8-(4-O-β-D-glucopyranosyl-β-D-glucopyranosyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-;8-((2S,3R,4R,5S,6R)-3,4-Dihydroxy-6-(hydroxymethyl)-5-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one;Vitexin -4''-O-glucoside;4''-O-Glucosylvitexin;Vitexin-4''''-O-glucoside;Vitexin-4''''-O-glucoside, 10 mM in DMSO | | CAS: | 178468-00-3 | | MF: | C27H30O15 | | MW: | 594.52 | | EINECS: | | | Product Categories: | | | Mol File: | 178468-00-3.mol |  |
| | Vitexin -4''-O-glucoside Chemical Properties |
| Boiling point | 947.3±65.0 °C(Predicted) | | density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 1 mg/ml,DMSO: 1 mg/ml,DMSO:PBS (pH 7.2) (1:1): 0.50 mg/ml,PBS (pH 7.2): slightly soluble | | form | Powder | | pka | 6.25±0.40(Predicted) | | color | Light yellow to yellow | | biological source | plant | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | NDSUKTASTPEKBX-LXXMDOISSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)c3c4[o]c(c[c](c4c(cc3O)O)=O)c5ccc(cc5)O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Vitexin -4''-O-glucoside Usage And Synthesis |
| Uses | Vitexin-4-O-glucoside is extracted from Hawthron leaves and can be used to improve digestion and circulation. | | Definition | ChEBI: Vitexin glucoside is a member of flavonoids and a C-glycosyl compound. | | Biological Activity | Inhibits glutamate release in the brain by lowering plasma concentrations. |
| | Vitexin -4''-O-glucoside Preparation Products And Raw materials |
|