- Cbz-D-Gln-OH
-
-
2026-08-14
- CAS:13139-52-1
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Z-D-GLN-OH
-
- $1.00
-
2020-01-03
- CAS:13139-52-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | Z-D-GLN-OH Basic information |
| Product Name: | Z-D-GLN-OH | | Synonyms: | BENZYLOXYCARBONYL-D-GLUTAMINE;CBZ-D-GLN-OH;N-CBZ-D-GLUTAMINE;(2R)-2-{[(benzyloxy)carbonyl]amino}-4-carbamoylbutanoic acid;N-ALPHA-CARBOBENZOXY-D-GLUTAMINE;N-ALPHA-CBZ-D-GLUTAMINE;Z-D-GLN-OH;Z-D-GLUTAMINE | | CAS: | 13139-52-1 | | MF: | C13H16N2O5 | | MW: | 280.28 | | EINECS: | | | Product Categories: | | | Mol File: | 13139-52-1.mol |  |
| | Z-D-GLN-OH Chemical Properties |
| Melting point | 138-142°C | | Boiling point | 604.2±55.0 °C(Predicted) | | density | 1.316 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 3.82±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C13H16N2O5/c14-11(16)7-6-10(12(17)18)15-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,16)(H,15,19)(H,17,18)/t10-/m1/s1 | | InChIKey | JIMLDJNLXLMGLX-SNVBAGLBSA-N | | SMILES | C(O)(=O)[C@@H](CCC(N)=O)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 13139-52-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 |
| | Z-D-GLN-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N2-Cbz-D-glutamine is an N-Cbz-protected form of D-Glutamine (G597295). D-Glutamine is an unnatural isomer of L-Glutamine (G597000) that is present in human plasma an is a source of liberated ammonia. D-Glutamine can be synthesized by enzymatic means or can be found in cheeses, wine and vinegars as well. It is often used to determine the activity of Glutamine synthetase, an enzyme that is commonly found in the mammalian liver and brain that controls the use of nitrogen in cells. |
| | Z-D-GLN-OH Preparation Products And Raw materials |
|