| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
4-(Trifluoromethyl)-D-phenylalanine manufacturers
|
| | 4-(Trifluoromethyl)-D-phenylalanine Basic information |
| | 4-(Trifluoromethyl)-D-phenylalanine Chemical Properties |
| Boiling point | 311.5±42.0 °C(Predicted) | | density | 1.364±0.06 g/cm3(Predicted) | | storage temp. | Store at -15°C | | pka | 2.15±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H10F3NO2/c11-10(12,13)7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16)/t8-/m1/s1 | | InChIKey | CRFFPDBJLGAGQL-MRVPVSSYSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC=C(C(F)(F)F)C=C1)N | | CAS DataBase Reference | 114872-99-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | 4-(Trifluoromethyl)-D-phenylalanine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 4-(Trifluoromethyl)-D-phenylalanine Preparation Products And Raw materials |
|