4-(Trifluoromethyl)-L-phenylalanine manufacturers
|
| | 4-(Trifluoromethyl)-L-phenylalanine Basic information |
| Product Name: | 4-(Trifluoromethyl)-L-phenylalanine | | Synonyms: | L-4-TRIFLUOROMETHYLPHE;4-(TRIFLUOROMETHYL)-L-PHENYLALANINE;L-4-TRIFLUOROMETHYLPHENYLALANINE;L-3-[4-(TRIFLUOROMETHYL)PHENYL]ALANINE;H-L-PHE(4-TRIFLUOROMETHYL)-OH;H-PHE(4-CF 3)-OH;(S)-2-AMINO-3-(4-TRIFLUOROMETHYL-PHENYL)-PROPIONIC ACID;RARECHEM BK PT 0139 | | CAS: | 114926-38-4 | | MF: | C10H10F3NO2 | | MW: | 233.19 | | EINECS: | | | Product Categories: | a-amino;Amino Acids | | Mol File: | 114926-38-4.mol |  |
| | 4-(Trifluoromethyl)-L-phenylalanine Chemical Properties |
| Boiling point | 311.5±42.0 °C(Predicted) | | density | 1.364±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | solid | | pka | 2.15±0.10(Predicted) | | color | White to yellow | | Optical Rotation | -16.23°(C=0.01g/ml MEOH) | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C10H10F3NO2/c11-10(12,13)7-3-1-6(2-4-7)5-8(14)9(15)16/h1-4,8H,5,14H2,(H,15,16)/t8-/m0/s1 | | InChIKey | CRFFPDBJLGAGQL-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(C(F)(F)F)C=C1)N | | CAS DataBase Reference | 114926-38-4(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922498590 |
| | 4-(Trifluoromethyl)-L-phenylalanine Usage And Synthesis |
| Uses | 4-fluoro-l-phenylalanine (fF), or 4-trifluoromethyl-l-phenylalanine were introduced inside the chain of peptides to enhances their antimicrobial activity.. | | Synthesis | Step 2: Diethyl 2-acetamido-2-(4-(trifluoromethyl)benzyl)malonate (LXII, theoretical amount 0.125 mol) was dissolved in acetone (400 mL) and 2 M aqueous NaOH solution (400 mL) was added. The reaction mixture was refluxed overnight and subsequently concentrated under reduced pressure to remove the solvent. The residue was dissolved in water and washed with hexane (3 x 400 mL). The aqueous phase was adjusted to pH=1 with acid and the precipitate was collected by filtration to afford 2-acetamido-3-(4-(trifluoromethyl)phenyl)propionic acid (LXIII) as a white solid (25.8 g, 93.7 mmol, 75% overall yield in two steps). | | References | [1] Patent: WO2012/109164, 2012, A1. Location in patent: Page/Page column 53-54 |
| | 4-(Trifluoromethyl)-L-phenylalanine Preparation Products And Raw materials |
|