|
|
| | 4-Hydroxymethyl-3-nitrobenzoic acid Basic information | | Uses |
| | 4-Hydroxymethyl-3-nitrobenzoic acid Chemical Properties |
| Boiling point | 412.9±40.0 °C(Predicted) | | density | 1.544±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.46±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H7NO5/c10-4-6-2-1-5(8(11)12)3-7(6)9(13)14/h1-3,10H,4H2,(H,11,12) | | InChIKey | KUOYLJCVVIDGBZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(CO)C([N+]([O-])=O)=C1 |
| | 4-Hydroxymethyl-3-nitrobenzoic acid Usage And Synthesis |
| Uses | 4-Hydroxymethyl-3-nitrobenzoic acid is a chemical synthesis and reaction reagent whose mechanism of action is fundamentally due to its reactive functional groups. The hydroxymethyl group is a multifunctional agent for nucleophilic addition reactions, while the nitro group on the benzene ring has electron-withdrawing properties, which can enhance the reactivity of electrophilic substitution reactions at adjacent positions. This dual function makes it an important tool for synthesizing complex molecules and a cornerstone for constructing various chemical structures. In addition, its benzoic acid molecule can also participate in condensation reactions, thereby improving its practicality in the manufacture of polymers or as a precursor for the synthesis of esters and amides. The wide applicability of this compound in these fields highlights its important significance in promoting research in materials science, organic synthesis, and the development of novel chemical methods. |
| | 4-Hydroxymethyl-3-nitrobenzoic acid Preparation Products And Raw materials |
|