| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate Basic information |
| Product Name: | 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate | | Synonyms: | 2,2-dimethyl-1,3-dioxolan-4-ylmethyl P-toluenesul;2-(4-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl)-4-methylbenzenesulfonic acid;DL-Tosylisopropylideneglycerol;(+/-)-1,2-(Isopropylidene)glycerol 3-(p-Toluenesulfonate);1,2-Isopropylidenedioxy-3-tosyloxypropane;2,2-DiMethyl-1,3-dioxolane-4-Methanol 4-(4-Methylbenzenesulfonate);2,2-DiMethyl-1,3-dioxolane-4-Methanol p-Toluenesulfonate;NSC 36147 | | CAS: | 7305-59-1 | | MF: | C13H18O5S | | MW: | 286.35 | | EINECS: | | | Product Categories: | Sulfur & Selenium Compounds;Miscellaneous Reagents;Carbohydrates & Derivatives;Tosylates;Sulfur Compounds;Organic Building Blocks | | Mol File: | 7305-59-1.mol |  |
| | 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate Chemical Properties |
| Melting point | 47-49 °C (lit.) | | Boiling point | 400.1±25.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | solubility | Chloroform, | | form | Solid | | color | White | | InChI | 1S/C13H18O5S/c1-10-4-6-12(7-5-10)19(14,15)17-9-11-8-16-13(2,3)18-11/h4-7,11H,8-9H2,1-3H3 | | InChIKey | SRKDUHUULIWXFT-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)OCC2COC(C)(C)O2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Protected D,L-Glycerol. |
| | 2,2-Dimethyl-1,3-dioxolan-4-ylmethyl p-toluenesulfonate Preparation Products And Raw materials |
|