| Company Name: |
Biokitchen Gold |
| Tel: |
021-021-021-31663258 13795219287 |
| Email: |
donghuanwen@126.com |
4-Amino-5-chloropyridazin-6-on manufacturers
|
| | 4-Amino-5-chloropyridazin-6-on Basic information |
| | 4-Amino-5-chloropyridazin-6-on Chemical Properties |
| Melting point | 297-300°C (dec.) | | density | 1.79±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) | | form | Solid | | pka | 9.29±0.60(Predicted) | | color | Pale Brown to Brown | | InChI | InChI=1S/C4H4ClN3O/c5-3-2(6)1-7-8-4(3)9/h1H,(H3,6,8,9) | | InChIKey | FEWPCPCEGBPTAL-UHFFFAOYSA-N | | SMILES | C1(=O)NN=CC(N)=C1Cl | | EPA Substance Registry System | 3(2H)-Pyridazinone, 5-amino-4-chloro- (6339-19-1) |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Amino-5-chloropyridazin-6-on Usage And Synthesis |
| Chemical Properties | Tan Solid | | Uses | The metabolite in soil and sugar beets of Chloridazon. | | Definition | ChEBI: A heteroaryl hydroxy compound that is pyridazin-3-ol substituted by an amino group at position 5 and a chloro group at position 4. It is a metabolite of the herbicide chloridazone. |
| | 4-Amino-5-chloropyridazin-6-on Preparation Products And Raw materials |
|