- Oxamic hydrazide
-
-
2026-06-30
- CAS:515-96-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- Oxamic hydrazide
-
- $1.00
-
2024-10-22
- CAS:515-96-8
- Min. Order: 1g
- Purity: MIn98% HPLC/LC
- Supply Ability: 100KGS
|
| | Oxamic hydrazide Basic information |
| Product Name: | Oxamic hydrazide | | Synonyms: | aminooxo-aceticacihydrazide;carbamoylformicacidhydrazide;1-(hydrazinecarbonyl)formamide;n-aminooxamide;semioxamazid;AMINO-OXAMIDE;OXAMIC ACID HYDRAZIDE;OXAMIC HYDRAZIDE | | CAS: | 515-96-8 | | MF: | C2H5N3O2 | | MW: | 103.08 | | EINECS: | 208-213-2 | | Product Categories: | | | Mol File: | 515-96-8.mol |  |
| | Oxamic hydrazide Chemical Properties |
| Melting point | 216-218 °C (dec.)(lit.) | | Boiling point | 193.27°C (rough estimate) | | density | 1.5048 (rough estimate) | | refractive index | 1.4264 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 10.72±0.20(Predicted) | | form | Powder | | color | White | | Merck | 14,8445 | | InChI | InChI=1S/C2H5N3O2/c3-1(6)2(7)5-4/h4H2,(H2,3,6)(H,5,7) | | InChIKey | MOKRDWKSHLLYKM-UHFFFAOYSA-N | | SMILES | C(NN)(=O)C(N)=O | | CAS DataBase Reference | 515-96-8(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 36/37/39-45-24/25 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | AF2620000 | | HazardClass | 4.1 | | PackingGroup | III | | HS Code | 29280000 | | Toxicity | LDLo ipr-mus: 185 mg/kg JPETAB 122,110,1958 |
| | Oxamic hydrazide Usage And Synthesis |
| Chemical Properties | white powder | | Uses | As a reagent for aldehydes and ketones. | | Safety Profile | A poison by intraperitoneal route. When heated to decomposition it emits toxic vapors of NOx. |
| | Oxamic hydrazide Preparation Products And Raw materials |
|