|
|
| | AR-13324 (mesylate) Basic information |
| Product Name: | AR-13324 (mesylate) | | Synonyms: | AR-13324 (mesylate);Benzoic acid, 2,4-dimethyl-, [4-[(1S)-1-(aminomethyl)-2-(6-isoquinolinylamino)-2-oxoethyl]phenyl]methyl ester, methanesulfonate (1:2);AR-13324; AR13324; AR 13324; NETARSUDIL MESYLATE; RHOPRESSA;;Netarsudil Mesylate (AR-13324);(S)-4-(3-Amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl)benzyl 2,4-dimethylbenzoate dimethanesulfonate;Netarsudil ophthalmi;AR-13324 Dimesylate;Netarsudil?API | | CAS: | 1422144-42-0 | | MF: | C28H27N3O3.2CH4O3S | | MW: | 645.75 | | EINECS: | | | Product Categories: | API | | Mol File: | 1422144-42-0.mol |  |
| | AR-13324 (mesylate) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | Solid | | color | White to yellow | | InChIKey | QQDRLKRHJOAQDC-FBHGDYMESA-N | | SMILES | S(O)(=O)(=O)C.N(C1C=CC2C=NC=CC=2C=1)C(=O)[C@@H](C1C=CC(=CC=1)COC(C1C=CC(=CC=1C)C)=O)CN.S(O)(=O)(=O)C |
| | AR-13324 (mesylate) Usage And Synthesis |
| Uses | AR-13324 mesylate can be useful in asymmetric synthesis of netarsudil: a new therapeutic for open-angle glaucoma. |
| | AR-13324 (mesylate) Preparation Products And Raw materials |
|