METHYL 4-METHYLCINNAMATE manufacturers
- METHYL 4-METHYLCINNAMATE
-
- $33.00 / 1kg
-
2025-09-25
- CAS:20754-20-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | METHYL 4-METHYLCINNAMATE Chemical Properties |
| Melting point | 60-61℃ | | Boiling point | 273℃ | | density | 1.057 | | Fp | 152℃ | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H12O2/c1-9-3-5-10(6-4-9)7-8-11(12)13-2/h3-8H,1-2H3/b8-7+ | | InChIKey | WLJBRXRCJNSDHT-BQYQJAHWSA-N | | SMILES | C(OC)(=O)/C=C/C1=CC=C(C)C=C1 |
| | METHYL 4-METHYLCINNAMATE Usage And Synthesis |
| Uses | Methyl p-methylcinnamate is a pharmaceutical intermediate used in the synthesis of the antithrombotic drug ozagrel sodium. | | Application | Methyl methyl cinnamate has a high ultraviolet light absorption rate and can effectively resist ultraviolet rays in the range of 280~320nm. It is widely used in sunscreen cosmetics, textiles, polymers and pharmaceutical intermediates. | | Synthesis Reference(s) | Synthetic Communications, 17, p. 1839, 1987 DOI: 10.1080/00397918708077329 |
| | METHYL 4-METHYLCINNAMATE Preparation Products And Raw materials |
|