|
|
| | PROFLURALIN Basic information |
| | PROFLURALIN Chemical Properties |
| Melting point | 34℃ | | Boiling point | 393.3±42.0 °C(Predicted) | | density | 1.3516 (estimate) | | storage temp. | -20°C | | form | Liquid | | pka | -2.01±0.50(Predicted) | | Water Solubility | 0.1mg/L(27 ºC) | | Merck | 13,7862 | | Henry's Law Constant | 3.4×10-2 mol/(m3Pa) at 25℃, HSDB (2015) | | Major Application | agriculture
environmental | | InChI | 1S/C14H16F3N3O4/c1-2-5-18(8-9-3-4-9)13-11(19(21)22)6-10(14(15,16)17)7-12(13)20(23)24/h6-7,9H,2-5,8H2,1H3 | | InChIKey | ITVQAKZNYJEWKS-UHFFFAOYSA-N | | SMILES | CCCN(CC1CC1)c2c(cc(cc2[N+]([O-])=O)C(F)(F)F)[N+]([O-])=O | | EPA Substance Registry System | Profluralin (26399-36-0) |
| Hazard Codes | Xi,N | | Risk Statements | 36-50/53 | | Safety Statements | 60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | WGK 2 | | RTECS | XU5785000 | | HS Code | 29214300 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2 | | Hazardous Substances Data | 26399-36-0(Hazardous Substances Data) | | Toxicity | rabbit,LD50,skin,13754mg/kg (13754mg/kg),Ciba-Geigy Toxicology Data/Indexes. Vol. -, Pg. -, 1977. |
| | PROFLURALIN Usage And Synthesis |
| Uses | Herbicide. | | Definition | ChEBI: Profluralin is a C-nitro compound. | | Production Methods | Profluralin was manufactured through a nitrated dinitroaniline route characteristic of this herbicide class. Industrial production generally began with the alkylation of a suitably substituted aniline to introduce the isopropyl side chain, followed by controlled nitration to generate the required dinitroaniline core while limiting over nitration. This intermediate was then reacted with 3,3,3 trifluoropropyl chloride or a related halide under basic, anhydrous conditions to install the trifluoropropyl group, forming the final herbicidal structure. Purification typically involved solvent washing and crystallisation to achieve technical grade profluralin before formulation. | | Mechanism of action | Selective, absorbed by roots and shoots. Dinitroaniline herbicides work by disrupting microtubule formation, specifically inhibiting tubulin polymerization in plant cells, thus disrupting plant division | | Pesticide Type | Herbicide |
| | PROFLURALIN Preparation Products And Raw materials |
|