4-Chloro-1-(3-fluorophenyl)-1-oxobutane manufacturers
|
| | 4-Chloro-1-(3-fluorophenyl)-1-oxobutane Basic information |
| Product Name: | 4-Chloro-1-(3-fluorophenyl)-1-oxobutane | | Synonyms: | 4-Chloro-1-(3-Fluorophenyl)-1-Butanone;1-Butanone, 4-chloro-1-(3-fluorophenyl)-;Haloperidol Impurity 36;Haloperidol impurities5;4-Chloro-1-(3-fluorophenyl)-1-oxobutane | | CAS: | 3110-52-9 | | MF: | C10H10ClFO | | MW: | 200.64 | | EINECS: | | | Product Categories: | | | Mol File: | 3110-52-9.mol |  |
| | 4-Chloro-1-(3-fluorophenyl)-1-oxobutane Chemical Properties |
| Boiling point | 105-125 °C(Press: 2 Torr) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H10ClFO/c11-6-2-5-10(13)8-3-1-4-9(12)7-8/h1,3-4,7H,2,5-6H2 | | InChIKey | PLSCLNABOWDJKS-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(F)=C1)(=O)CCCCl |
| | 4-Chloro-1-(3-fluorophenyl)-1-oxobutane Usage And Synthesis |
| | 4-Chloro-1-(3-fluorophenyl)-1-oxobutane Preparation Products And Raw materials |
|