- Voriconazole
-
- $0.00 / 10mg
-
2025-12-16
- CAS:456-04-2
- Min. Order: 10mg
- Purity: 98
- Supply Ability: 10000000
|
| | 2-Chloro-4'-fluoroacetophenone Basic information |
| | 2-Chloro-4'-fluoroacetophenone Chemical Properties |
| Melting point | 47-50 °C(lit.) | | Boiling point | 247°C | | density | 1.2752 (estimate) | | vapor pressure | 1.9Pa at 27.1℃ | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Flakes or Platelets | | color | Light yellow to yellow-beige | | Water Solubility | Insoluble in water. | | Sensitive | Lachrymatory | | BRN | 637860 | | InChI | InChI=1S/C8H6ClFO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 | | InChIKey | UJZWJOQRSMOFMA-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(F)C=C1)CCl | | CAS DataBase Reference | 456-04-2(CAS DataBase Reference) | | NIST Chemistry Reference | «ALPHA»-chloro-para-fluoroacetophenone(456-04-2) |
| | 2-Chloro-4'-fluoroacetophenone Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW TO YELLOW-BEIGE FLAKES OR PLATELETS | | Uses | 1-methyl-2-(4-methylthio)phenyl-4-(4-fluoro)phenylimidazole which was synthesized by condensing N-methyl-4-(methylthio)benzamidine with 2-chloro-4?-fluoroacetophenone. | | General Description | 2-Chloro-4′-fluoroacetophenone on condensation with N-methyl-4-(methylthio)benzamidine yields 1-methyl-2-(4-methylthio)phenyl-4-(4-fluoro)phenylimidazole. |
| | 2-Chloro-4'-fluoroacetophenone Preparation Products And Raw materials |
|