| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine Basic information |
| Product Name: | 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine | | Synonyms: | 3-CHLORO-5-ACETYL-10,11-DIHYDRO-DIBENZO[B,F] AZEPINE;3-CHLORO-5-ACETYLIMINODIBENZYL;5-ACETYL-3-CHLORO-10,11-DIHYDRO-5H-DIBENZ[B,F]AZEPINE;1-(3-CHLORO-10,11-DIHYDRO-DIBENZO[B,F]AZEPIN-5-YL)-ETHANONE;5-Acetyl-3-chloro-10,11-dihydro-5H-dibenzazepine;5-ACETYL-3-CHLOROIMINODIBENZYL;5-Acetyl-3-chlor-10,11-dihydro-5H-dibenz[b,f]azepin;N-Acetyl-3-chloro-2-benzyl | | CAS: | 25961-11-9 | | MF: | C16H14ClNO | | MW: | 271.74 | | EINECS: | 247-371-7 | | Product Categories: | (intermediate of chlorimipramine) | | Mol File: | 25961-11-9.mol | ![5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine Structure](CAS/GIF/25961-11-9.gif) |
| | 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine Chemical Properties |
| Melting point | 124 °C | | Boiling point | 481.2±45.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -3.29±0.20(Predicted) | | color | White | | InChI | InChI=1S/C16H14ClNO/c1-11(19)18-15-5-3-2-4-12(15)6-7-13-8-9-14(17)10-16(13)18/h2-5,8-10H,6-7H2,1H3 | | InChIKey | NMZOSOMVILZBJL-UHFFFAOYSA-N | | SMILES | C(=O)(N1C2=CC=CC=C2CCC2=CC=C(Cl)C=C12)C | | CAS DataBase Reference | 25961-11-9(CAS DataBase Reference) |
| | 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine Usage And Synthesis |
| Uses | 5-Acetyl-3-chloroiminodibenzyl is used as a reactant in various syntheses. It was used in the synthesis of solid pyridylzinc reagents with application in Negishi Reactions. Carbamazephine Impurity 1. |
| | 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine Preparation Products And Raw materials |
|