|
|
| | 1,4-Dioxa-spiro[4.5]decan-8-ol Basic information |
| Product Name: | 1,4-Dioxa-spiro[4.5]decan-8-ol | | Synonyms: | 4-HYDROXYCYCLOHEXANONE MONOETHYLENE KETAL;4,4-Ethylenedioxycyclohexanol.;4-Hydroxycyclohexanone ethylene acetal, 90+%;4,4-(Ethylenebisoxy)cyclohexanol;1,4-Dioxaspiro[4.5]decan-8-ol,98%;4-Dioxaspiro[4.5]decan-8-ol;4-Hydroxycyclohexanone ethylene acetal;4-Hydroxycyclohexan-1-one monoethylene ketal 98% | | CAS: | 22428-87-1 | | MF: | C8H14O3 | | MW: | 158.2 | | EINECS: | | | Product Categories: | Miscellaneous | | Mol File: | 22428-87-1.mol | ![1,4-Dioxa-spiro[4.5]decan-8-ol Structure](CAS/GIF/22428-87-1.gif) |
| | 1,4-Dioxa-spiro[4.5]decan-8-ol Chemical Properties |
| Boiling point | 103-104 °C(Press: 0.55 Torr) | | density | 1.17±0.1 g/cm3(Predicted) | | refractive index | 1.485-1.487 | | storage temp. | Inert atmosphere,2-8°C | | pka | 15.11±0.20(Predicted) | | form | Viscous Liquid | | color | Clear colorless | | InChI | InChI=1S/C8H14O3/c9-7-1-3-8(4-2-7)10-5-6-11-8/h7,9H,1-6H2 | | InChIKey | HKQTYQDNCKMNHZ-UHFFFAOYSA-N | | SMILES | O1C2(CCC(O)CC2)OCC1 |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | HazardClass | IRRITANT | | HS Code | 29339900 |
| Provider | Language |
|
ACROS
| English |
| | 1,4-Dioxa-spiro[4.5]decan-8-ol Usage And Synthesis |
| Chemical Properties | clear colorless viscous liquid | | Uses | 1,4-Dioxaspiro[4.5]decan-8-ol can be used to synthesize pharmaceutical compounds such as diuretics. | | Synthesis | Step A: Preparation of 4-dioxaspiro[4.5]decan-8-ol
1,4-Cyclohexanedione monoethylene glycol ketal (5.0134 g, 32.10 mmol) was dissolved in methanol (100 mL) and cooled in an ice bath. Sodium borohydride (3.64 g, 96.30 mmol) was added to the solution in batches over 20 min. The reaction mixture was stirred at 0 °C for 30 min, then slowly warmed to room temperature and continued stirring for 1 h. The reaction mixture was then stirred at 0 °C for 1 h. The reaction mixture was then stirred at 0 °C for 1 h. Upon completion of the reaction, 4-hydroxycyclohexanone ethylene glycol acetal (5.56 g, 109% yield) was obtained by a standard post-processing step, the product was a yellow oil and could be used in subsequent reactions without further purification. The structure of the product was confirmed by 1H NMR (400 MHz, chloroform-D): δ 1.47-1.70 (m, 5H), 1.72-1.92 (m, 4H), 3.70-3.83 (m, 1H), 3.85-3.96 (m, 4H). | | References | [1] Journal of Medicinal Chemistry, 1992, vol. 35, # 12, p. 2243 - 2247
[2] Journal of the American Chemical Society,
[3] Journal of the American Chemical Society, 2009, vol. 131, p. 251 - 262
[4] Patent: US2009/275574, 2009, A1. Location in patent: Page/Page column 16
[5] Patent: WO2013/30665, 2013, A1. Location in patent: Page/Page column 175; 176 |
| | 1,4-Dioxa-spiro[4.5]decan-8-ol Preparation Products And Raw materials |
|