|
|
| | 4-HYDROXYCYCLOHEXANONE Basic information | | Uses |
| Product Name: | 4-HYDROXYCYCLOHEXANONE | | Synonyms: | 4-HYDROXYCYCLOHEXANONE;4-Hydroxycyclohexanon;4-hydroxycyclohexanone(SALTDATA: FREE);4-Oxocyclohexan-1-ol;4-Oxocyclohexan-1-ol, 1-Hydroxy-4-oxocyclohexane;4-HYDROXYCYCLOHEXANONE 13482-22-9;4-Hydroxycyclohexano;4-hydroxy-Cyclohexanone, 97%min | | CAS: | 13482-22-9 | | MF: | C6H10O2 | | MW: | 114.14 | | EINECS: | | | Product Categories: | pharmacetical;Miscellaneous | | Mol File: | 13482-22-9.mol |  |
| | 4-HYDROXYCYCLOHEXANONE Chemical Properties |
| Melting point | -1°C | | Boiling point | 256°C | | density | 1,1 g/cm3 | | Fp | 124°C | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.62±0.20(Predicted) | | form | liquid | | color | Colourless to light yellow | | InChI | InChI=1S/C6H10O2/c7-5-1-2-6(8)4-3-5/h5,7H,1-4H2 | | InChIKey | BXBJZYXQHHPVGO-UHFFFAOYSA-N | | SMILES | C1(=O)CCC(O)CC1 | | CAS DataBase Reference | 13482-22-9(CAS DataBase Reference) |
| | 4-HYDROXYCYCLOHEXANONE Usage And Synthesis |
| Uses | 4-Hydroxycyclohexanone can be used as an organic synthesis intermediate. It can be obtained by reducing and deprotecting 1,4-dioxanespiro[4,5]cyclohex-8-one with sodium borohydride. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 45, p. 40, 1980 DOI: 10.1021/jo01289a010 Synthesis, p. 774, 1986 DOI: 10.1055/s-1986-31775 Tetrahedron Letters, 35, p. 4169, 1994 DOI: 10.1016/S0040-4039(00)73141-8 |
| | 4-HYDROXYCYCLOHEXANONE Preparation Products And Raw materials |
|