|
|
| | 4-Methylumbelliferyl β-D-mannopyranoside Basic information |
| Product Name: | 4-Methylumbelliferyl β-D-mannopyranoside | | Synonyms: | 4-METHYLUMBELLIFERYL BETA-D-MANNOPYRANOSIDE;4-METHYLUMBELLIFERYL BETA-D-MANNOSIDE;4-METHYLUMBELLIFERYL B-D-MANNOPYRANOSIDE;4-MU-BETA-D-MAN;4-methylumbelliferyl β-d-mannoside;4-methyl-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-chromen-2-one;4-methyl-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;4-methyl-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methylol-tetrahydropyran-2-yl]oxy-coumarin | | CAS: | 67909-30-2 | | MF: | C16H18O8 | | MW: | 338.31 | | EINECS: | 1533716-785-6 | | Product Categories: | substrate;Carbohydrates & Derivatives;Fluorescent Labels & Indicators;Heterocycles | | Mol File: | 67909-30-2.mol |  |
| | 4-Methylumbelliferyl β-D-mannopyranoside Chemical Properties |
| Melting point | 235-237°C | | storage temp. | −20°C | | solubility | DMSO (Slightly), Pyridine (Slightly), Water (Slightly, Heated) | | form | Solid | | color | White to Off-White | | InChI | 1S/C16H18O8/c1-7-4-12(18)23-10-5-8(2-3-9(7)10)22-16-15(21)14(20)13(19)11(6-17)24-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15+,16-/m1/s1 | | InChIKey | YUDPTGPSBJVHCN-NZBFACKJSA-N | | SMILES | CC1=CC(=O)Oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc12 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 4-Methylumbelliferyl β-D-mannopyranoside Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | A substrate for mannosidase. Substrate inhibition was observed for all but the least reactive of these substrates. | | Uses | 4-Methylumbelliferyl β-D-mannopyranoside has been used as a fluorogenic substrate for β -mannosidase in the enzyme assay of mice tissue extracts, in cell-free translation and midgut of Lutzomyia longipalpis. | | Biochem/physiol Actions | 4-Methylumbelliferyl β-D-mannopyranoside is a fluorescent ligand for concanavalin A and interacts with its carbohydrate binding region. It is also a fluorogenic substrate for β-mannosidase. |
| | 4-Methylumbelliferyl β-D-mannopyranoside Preparation Products And Raw materials |
|