- TATIONIL
-
- $800.00
-
2019-07-06
- CAS:20167-21-9
- Min. Order: 25KG
- Purity: 89-92
- Supply Ability: 1T
|
| | Glutathione (reduced) sodium salt Basic information |
| Product Name: | Glutathione (reduced) sodium salt | | Synonyms: | GLUTATHIONE, MONOSODIUM SALT;GLUTATHIONE (REDUCED), SODIUM SALT;Tationil 600;Tationil 300;Glutathione Sodium sterile;Glutathione (reduced) sodium sal;L-Glutathione sodium, reduced;Reduced glutathione sodium | | CAS: | 20167-21-9 | | MF: | C10H18N3NaO6S | | MW: | 331.32 | | EINECS: | | | Product Categories: | API | | Mol File: | 20167-21-9.mol |  |
| | Glutathione (reduced) sodium salt Chemical Properties |
| InChI | InChI=1/C10H17N3O6S.Na.H/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;;/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);;/t5-,6-;;/s3 | | InChIKey | JOHWJZOCWZYVES-CAZAILOXNA-N | | SMILES | [C@@H](CS)(NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O.[NaH] |&1:0,8,r| |
| | Glutathione (reduced) sodium salt Usage And Synthesis |
| Uses | L-Glutathione reduced monosodium is an endogenous antioxidant and is capable of scavenging oxygen-derived free radicals. | | References | [1] Pereira-Rodrigues N, et al. Electrocatalytic activity of cobalt phthalocyanine CoPc adsorbed on a graphite electrode for the oxidation of reduced L-glutathione (GSH) and the reduction of its disulfide (GSSG) at physiological pH. Bioelectrochemistry. 2007 Jan;70(1):147-54. DOI:10.1016/j.bioelechem.2006.03.025 |
| | Glutathione (reduced) sodium salt Preparation Products And Raw materials |
|