|
|
| | 2-Phenylisobutyric acid Basic information |
| | 2-Phenylisobutyric acid Chemical Properties |
| Melting point | 80-82°C | | Boiling point | 146.5°C | | density | 1.089±0.06 g/cm3(Predicted) | | Fp | 146.5°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.39±0.10(Predicted) | | form | Crystalline | | color | White | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C10H12O2/c1-10(2,9(11)12)8-6-4-3-5-7-8/h3-7H,1-2H3,(H,11,12) | | InChIKey | YYEROYLAYAVZNW-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)C(C)(C)C(=O)O | | LogP | 2.3 at 20℃ | | CAS DataBase Reference | 826-55-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 1 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 2-Phenylisobutyric acid Usage And Synthesis |
| Uses | 2-Methyl-2-phenylpropionic acid is used in the synthesis of Fexofenadine hydrochloride | | Uses | Used in the synthesis of Fexofenadine hydrochloride (F322470). | | Synthesis Reference(s) | The Journal of Organic Chemistry, 23, p. 1636, 1958 DOI: 10.1021/jo01105a014 |
| | 2-Phenylisobutyric acid Preparation Products And Raw materials |
|