- 1-Tetralol, (S)-
-
- $29.00
-
2026-05-11
- CAS:53732-47-1
- Purity: ≥98%
- Supply Ability: 10g
|
| | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol Basic information |
| Product Name: | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol | | Synonyms: | (S)-(+)-ALPHA-TETRALOL;(S)-(+)-1,2,3,4-TETRAHYDRO-1-NAPHTHOL;(S)-(+)-1,2,3,4-TETRAHYDRO-1-NAPHTHOL, 9 9% (99% EE/HPLC);(S)-(+)-1,2,3,4-tetrahydro-1-naphtol;(s)-(+)-α-tetralol;(S)-1,2,3,4-Tetrahydronaphthalen-1-ol;(S)-(+)-1,2,3,4-Tetrahydro-1-naphthol 99%;(S)-(+)-1,2,3,4-Tetrahydro-1-naphthol | | CAS: | 53732-47-1 | | MF: | C10H12O | | MW: | 148.2 | | EINECS: | | | Product Categories: | Chiral Building Blocks;Simple Alcohols (Chiral);Synthetic Organic Chemistry;Chiral | | Mol File: | 53732-47-1.mol |  |
| | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol Chemical Properties |
| Melting point | 37-39 °C | | Boiling point | 92 °C / 1.8mmHg | | density | 1.09 g/mL at 25 °C(lit.) | | refractive index | 33 ° (C=2.5, CHCl3) | | Fp | 113 °C | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 14.33±0.20(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D +33±1°, c = 2.5% in chloroform | | BRN | 2208779 | | InChI | InChI=1S/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10-11H,3,5,7H2/t10-/m0/s1 | | InChIKey | JAAJQSRLGAYGKZ-JTQLQIEISA-N | | SMILES | [C@@H]1(O)C2=C(C=CC=C2)CCC1 | | CAS DataBase Reference | 53732-47-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | QL5075000 | | HS Code | 2907.19.8000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol Usage And Synthesis |
| Uses | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol is a building block used in pharmaceutical chemistry such as in the synthesis of a potent and orally bioavailable GPR40 agonist acting as a novel insulin secretagogues with low risk of hypoglycemia | | General Description | Chiral building block. |
| | (S)-(+)-1,2,3,4-Tetrahydro-1-naphthol Preparation Products And Raw materials |
|