| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-8-PHENYLMENTHYL CHLOROACETATE Basic information |
| Product Name: | (+)-8-PHENYLMENTHYL CHLOROACETATE | | Synonyms: | (+)-8-PHENYLMENTHYL CHLOROACETATE;(1R,2S,5R)-(+)-5-METHYL-2-(1-METHYL-1-PHENYLETHYL)CYCLOHEXYL CHLOROACETATE;(1R,2S,5R)-(+)-5-methyl-2-(1-methyl-1-phenylethyl;(1R,2S,5R)-(+)-5-METHYL-2-(1-METHYL-1-PH ENYLETHYL)CYCLOHEXYL CL-ACETATE, 99%;Acetic acid, chloro-, (1R,2S,5R)-5-methyl-2-(1-methyl-1-phenylethyl)cyclohexyl ester;Acetic acid, 2-chloro-, (1R,2S,5R)-5-methyl-2-(1-methyl-1-phenylethyl)cyclohexyl ester;(1R,2S,5R)-(+)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate | | CAS: | 71804-27-8 | | MF: | C18H25ClO2 | | MW: | 308.84 | | EINECS: | | | Product Categories: | | | Mol File: | 71804-27-8.mol |  |
| | (+)-8-PHENYLMENTHYL CHLOROACETATE Chemical Properties |
| Melting point | 82-84 °C (lit.) | | Boiling point | 385.281±15.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.084±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | Optical Rotation | [α]25/D +22°, c = 1.2 in carbon tetrachloride | | InChI | 1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3/t13-,15-,16-/m1/s1 | | InChIKey | GYWWQECFQIGECM-FVQBIDKESA-N | | SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCl)C(C)(C)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (+)-8-PHENYLMENTHYL CHLOROACETATE Usage And Synthesis |
| Uses | (1R,2S,5R)-(+)-5-Methyl-2-(1-methyl-1-phenylethyl)cyclohexyl chloroacetate may be used in the synthesis of (-)-8-phenyl-menthol, (+)-8-phenylmenthyl isocyanoacetate and (+)-cularine. |
| | (+)-8-PHENYLMENTHYL CHLOROACETATE Preparation Products And Raw materials |
|