Haloxyfop-etotyl manufacturers
- haloxyfop-etotyl
-
- $1.00
-
2020-02-06
- CAS:87237-48-7
- Min. Order: 1KG
- Purity: Min98% HPLC
|
| | Haloxyfop-etotyl Basic information |
| Product Name: | Haloxyfop-etotyl | | Synonyms: | 2-(4-((3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)-propanoicaci2-ethoxyethylester;dowco453ee;Haloxyfop-2-ethoxymethyl;gallant;haloxyfop-etotyl(unstatedstereochemistry);zellek;HALOXYFOP-ETHOXYETHYL;Haloxyfop-etotyl | | CAS: | 87237-48-7 | | MF: | C19H19ClF3NO5 | | MW: | 433.81 | | EINECS: | 402-560-5 | | Product Categories: | | | Mol File: | 87237-48-7.mol |  |
| | Haloxyfop-etotyl Chemical Properties |
| Melting point | 60°C | | Boiling point | 463.4±45.0 °C(Predicted) | | density | 1.3400 | | Fp | >100 °C | | pka | -1.53±0.32(Predicted) | | BRN | 8397167 | | Henry's Law Constant | 3.8×104 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C19H19ClF3NO5/c1-3-26-8-9-27-18(25)12(2)28-14-4-6-15(7-5-14)29-17-16(20)10-13(11-24-17)19(21,22)23/h4-7,10-12H,3,8-9H2,1-2H3 | | InChIKey | MIJLZGZLQLAQCM-UHFFFAOYSA-N | | SMILES | CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(cc2Cl)C(F)(F)F)cc1 | | CAS DataBase Reference | 87237-48-7(CAS DataBase Reference) | | NIST Chemistry Reference | Haloxyfop-ethoxyethyl(87237-48-7) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 22-36-60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | UA2458260 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Haloxyfop-etotyl Usage And Synthesis |
| Uses | Haloxyfop-etotyl is a herbicide that is active against most grasses. | | Production Methods | Haloxyfop-etotyl is commercially synthesised by esterifying haloxyfop acid with 2-ethoxyethanol. The production process begins with the preparation of haloxyfop acid, which involves the reaction of a chlorinated pyridyl ether with a phenoxypropionic acid derivative. This intermediate is then esterified with 2-ethoxyethanol in the presence of a suitable acid catalyst to form the ethoxyethyl ester, haloxyfop-etotyl. The reaction is conducted under controlled temperature and solvent conditions to ensure high yield and purity. | | Definition | ChEBI: 2-ethoxyethyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate is a carboxylic ester that is the resulting from the formal condensation of the carboxy group of 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid with the hydroxy group of 2-ethoxyethanol. It is an aromatic ether, an organochlorine compound, an organofluorine compound, a member of pyridines and a carboxylic ester. It is functionally related to a 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid and a 2-ethoxyethanol. | | Mechanism of action | Selective, absorbed by roots and foliage. Acetyl CoA carboxylase inhibitor (ACCase) - distrupts fatty acid biosynthesis and lipid formation. | | Pesticide Type | Herbicide |
| | Haloxyfop-etotyl Preparation Products And Raw materials |
|