|
|
| | Pentaerythritol Tetra(3-mercaptopropionate) Basic information |
| | Pentaerythritol Tetra(3-mercaptopropionate) Chemical Properties |
| Boiling point | 275 °C1 mm Hg(lit.) | | density | 1.28 g/mL at 25 °C(lit.) | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.531(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C, stored under nitrogen | | solubility | Practically insoluble in water | | form | clear liquid | | pka | 8.99±0.10(Predicted) | | Specific Gravity | 1.28 | | color | Colorless to Almost colorless | | Water Solubility | 3.69mg/L at 20℃ | | BRN | 2312625 | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | 1S/C17H28O8S4/c18-13(1-5-26)22-9-17(10-23-14(19)2-6-27,11-24-15(20)3-7-28)12-25-16(21)4-8-29/h26-29H,1-12H2 | | InChIKey | JOBBTVPTPXRUBP-UHFFFAOYSA-N | | SMILES | SCCC(=O)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS | | LogP | 2.8 at 30℃ | | CAS DataBase Reference | 7575-23-7(CAS DataBase Reference) | | EPA Substance Registry System | Propanoic acid, 3-mercapto-, 2,2-bis[(3-mercapto-1-oxopropoxy)methyl]-1,3-propanediyl ester (7575-23-7) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 36/37/38-50/53-43-22 | | Safety Statements | 26-36-61-60-36/37 | | RIDADR | UN 3334 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2930.90.9250 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | Pentaerythritol Tetra(3-mercaptopropionate) Usage And Synthesis |
| Description | Pentaerythritol Tetra(3-mercaptopropionate), also known as pentaerythritol tetra-3-mercaptopropionate, pentaerythritol tetra (3-mercaptopropionate) (PETMP), colorless liquids, water-insoluble, and widely used as intermediates for organic synthesis, modifiers in polymerization reactions such as UV coatings, inks, adhesives, etc., crosslinking agents, acidic ion exchange catalysts, low-temperature curing agents, etc. At present, the main production mode is catalytic esterification of pentaerythritol and mercaptopropionic acid. The catalysts used are mostly methanesulfonic acid, p-toluenesulfonic acid, and the like, and the synthesized product has a tetraester content of less than 70%. | | Uses | Pentaerythritol Tetra(3-mercaptopropionate) can be used for additives for hair treatments. | | Application | Pentaerythritol Tetra(3-mercaptopropionate) can be used as a precursor to synthesize:
Polymeric degradable networks through thiol-ene click reactions with tri/tetra-acrylates.
Thiol-ene-methacrylate composites, which are applicable as dental restorative materials.
Network solid polymer electrolytes based on polydimethylsiloxane, for lithium-ion batteries.
It can also be used to functionalize poly(high internal phase emulsions) for removal of heavy metals from water. | | Flammability and Explosibility | Non flammable |
| | Pentaerythritol Tetra(3-mercaptopropionate) Preparation Products And Raw materials |
|