- P-QUATERPHENYL
-
- $2.00
-
2019-07-06
- CAS:135-70-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | P-QUATERPHENYL Basic information |
| Product Name: | P-QUATERPHENYL | | Synonyms: | 1-phenyl-4-(4-phenylphenyl)benzene;1,1’:4’,1’’:4’’,1’’’-Quaterphenyl;1,1'-Biphenyl, 4,4'-diphenyl-;4-Quaterphenyl,99%,pure,scintillation grade;4-Quaterphenyl,99+%,pure,laser grade;4-Quaterphenyl, laser grade, pure, 99+%;Dixenyl;p,p'-Quaterphenyl | | CAS: | 135-70-6 | | MF: | C24H18 | | MW: | 306.4 | | EINECS: | 205-213-4 | | Product Categories: | Materials Science;Organic and Printed Electronics;Organic Building Blocks;Photonic and Optical Materials;Scintillators;Electroluminescence;Functional Materials;Highly Purified Reagents;Other Categories;Refined Products by Sublimation;Arenes;Building Blocks;Chemical Synthesis;Laser Dyes | | Mol File: | 135-70-6.mol |  |
| | P-QUATERPHENYL Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 428 °C18 mm Hg(lit.) | | density | 1.1138 (estimate) | | refractive index | 1.9130 (estimate) | | Fp | 428°C/18mm | | storage temp. | Storage temp. 2-8°C | | solubility | Hexanes (Slightly), Toluene (Slightly, Heated, Sonicated) | | form | powder to crystal | | color | White to Almost white | | BRN | 1912745 | | InChI | InChI=1S/C24H18/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H | | InChIKey | GPRIERYVMZVKTC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C3=CC=C(C4=CC=CC=C4)C=C3)C=C2)=CC=CC=C1 | | CAS DataBase Reference | 135-70-6(CAS DataBase Reference) | | NIST Chemistry Reference | p-Quaterphenyl(135-70-6) | | EPA Substance Registry System | p-Quaterphenyl (135-70-6) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29029090 |
| | P-QUATERPHENYL Usage And Synthesis |
| Description | p-Quaterphenyl is an extensively employed compound in the biomedical realm and boasts remarkable antioxidant and anticancer attributes owing to its exquisite structural configuration. Its profound therapeutic potential in combating diverse ailments such as lung cancer, breast cancer, and colon cancer has been unveiled. Apart from this, p-Quaterphenyl finds application in the assessment of effectiveness and safety of potential remedial drugs involved in drug discovery and development procedures. | | Chemical Properties | white powder | | Uses | As primary fluor or as wavelength shifter in
soluble scintillators. | | Definition | ChEBI: P-quaterphenyl is a benzenoid aromatic compound that consists of four phenyl groups connected to each other in the para position. It has a role as a chromophore. | | Purification Methods | p-Quaterphenyl [135-70-6] M 306.4, m 312-314o, b 4 2 8o/18mm. Recrystallise p-quaterphenyl from dimethyl sulfoxide at ca 50o. [Beilstein 5 II 669.] | | Excitation / Emission Maximum | 437 nm/477 nm |
| | P-QUATERPHENYL Preparation Products And Raw materials |
|
|
Tag:P-QUATERPHENYL(135-70-6)
Related Product Information
|
|
2-Ethyl-4-methyl imidazlium tetraphenyl borate
1,1':4',1'':4'',1'''-Quaterphenyl, 4,4'''-diphenyl-,p-Quaterphenyl, 4,4'''-diphenyl-
7-Bromo-9,9,9',9'-tetraethyl-2,2'-bifluorene
P-QUINQUEPHENYL
P-QUATERPHENYL
Hexaphenylbenzene
5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE VANADIUM(IV
1,1,4,4-Tetraphenyl-2,3,0-isopropylidene-D-threitol
[1,1',3',1",3",1"'-Quaterphenyl]-3,3'''-dicarbonaldehyde
tetraphenyl m-phenylene bis(phosphate)
2,2'-Bis(2-chlorophenyl)-4,4',5,5'-tetraphenyl-1,1'-biimidazole
2,2'-BIS(2-CHLOROPHENYL)-4,4',5,5'-TETRAPHENYL-1,2'-BIIMIDAZOLE [PHOTOPOLYMERIZATION INITIATOR]
3,3,5,5-tetraphenyl-2,2-biphenyl-4,4-yleneditetrazolium dichloride
( - )-2,3-O-Isopropylidene-1,1,4,4-tetraphenyl- L-threitol [(4R,5R)-2,2-Dimethyl-a,a,a’, a’-tetraphenyldioxolane-4,5-dimethanol
5,10,15,20-TETRAPHENYL-21H,23H-PORPHINE COBALT(II), SYNTHETIC,[5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-N21,N22,N23,N24]cobalt
Tetraphenyl dipropyleneglycol diphosphite
N,N'-Diphenylbenzidine
Benzopinacole
|