|
|
| | 2-AMINO-3,5-DIBROMOBENZONITRILE Basic information |
| Product Name: | 2-AMINO-3,5-DIBROMOBENZONITRILE | | Synonyms: | BUTTPARK 37\12-53;3,5-DIBROMOANTHRANILONITRILE;2-AMINO-3,5-DIBROMOBENZONITRILE;2-Amino-3,5-dibromobenzonitrile,99%;2-Amino-3,5-Dibromobenzonitrile 3,5-Dibromo-2-Aminobenzonitrile;3,5-Dibromo-2-Aminobenzonitrile;Benzonitrile, 2-amino-3,5-dibromo- | | CAS: | 68385-95-5 | | MF: | C7H4Br2N2 | | MW: | 275.93 | | EINECS: | | | Product Categories: | Organic Building Blocks;Building Blocks;C6 to C7;Chemical Synthesis;Nitrogen Compounds;Aromatic Nitriles;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds | | Mol File: | 68385-95-5.mol |  |
| | 2-AMINO-3,5-DIBROMOBENZONITRILE Chemical Properties |
| Melting point | 152-156 °C (lit.) | | Boiling point | 301.2±42.0 °C(Predicted) | | density | 1.9911 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | -0.95±0.10(Predicted) | | Appearance | Brown to khaki Solid | | InChI | InChI=1S/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 | | InChIKey | WLZCMGXAEXFAQA-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(Br)=CC(Br)=C1N | | CAS DataBase Reference | 68385-95-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 36/37/39-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids |
| | 2-AMINO-3,5-DIBROMOBENZONITRILE Usage And Synthesis |
| Chemical Properties | pinkish-brown or reddish-brown powder | | References | [1] European Journal of Organic Chemistry, 2010, # 34, p. 6588 - 6599
[2] Tetrahedron, 2016, vol. 72, # 35, p. 5323 - 5330
[3] Archiv der Pharmazie, 2018, vol. 351, # 9,
[4] Journal of the Chemical Society, Perkin Transactions 2, 2001, # 5, p. 738 - 744
[5] Synthesis (Germany), 2014, vol. 46, # 12, p. 1613 - 1620 |
| | 2-AMINO-3,5-DIBROMOBENZONITRILE Preparation Products And Raw materials |
|