- 3-Bromobenzonitrile
-
- $100.00 / 1KG
-
2025-09-25
- CAS:6952-59-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- 3-Bromobenzonitrile
-
- $30.00 / 1KG
-
2025-06-27
- CAS:6952-59-6
- Min. Order: 50KG
- Purity: 99%
- Supply Ability: 500000kg
- 3-Bromobenzonitrile
-
- $20.00 / 1kg
-
2025-06-20
- CAS:6952-59-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | 3-Bromobenzonitrile Basic information |
| | 3-Bromobenzonitrile Chemical Properties |
| Melting point | 38-40 °C(lit.) | | Boiling point | 225 °C(lit.) | | density | 1.562 | | refractive index | 1.5999 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | 0.2g/l | | form | Crystalline Mass, Crystals or Crystalline Powder | | color | White to light yellow or beige | | Water Solubility | Soluble in water (0.2 g/L) | | BRN | 1858942 | | InChI | InChI=1S/C7H4BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H | | InChIKey | STXAVEHFKAXGOX-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(Br)=C1 | | CAS DataBase Reference | 6952-59-6(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Bromobenzoic acid nitrile(6952-59-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-52/53-36-21/22 | | Safety Statements | 26-36-36/37/39-61 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | DI2459500 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Bromobenzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow or beige crystalline mass, | | Uses | 3-Bromobenzonitrile is involved in the Suzuki reaction under solvent-free conditions. |
| | 3-Bromobenzonitrile Preparation Products And Raw materials |
|