|
|
| | Diethyl(4-bromophenyl)phosphonate Basic information |
| Product Name: | Diethyl(4-bromophenyl)phosphonate | | Synonyms: | Diethyl (p-bromophenyl)phosphonate;Diethyl 4-bromobenzenephosphonate;Diethyl p-bromobenzenephosphonate;P-(4-Bromophenyl)phosphonic acid diethyl ester;Phosphonic acid,P-(4-bromophenyl)-, diethyl ester;1-Bromo-4-diethoxyphosphorylbenzene;Diethyl(4-bromophenyl)phosphonate, 98 %;(4-Bromophenyl)phosphonic Acid Diethyl Ester | | CAS: | 20677-12-7 | | MF: | C10H14BrO3P | | MW: | 293.09 | | EINECS: | | | Product Categories: | | | Mol File: | 20677-12-7.mol |  |
| | Diethyl(4-bromophenyl)phosphonate Chemical Properties |
| Melting point | 73-75℃ | | Boiling point | 120°C/0.4mmHg(lit.) | | density | 1.41 | | refractive index | 1.5240 to 1.5280 | | form | clear liquid | | color | Colorless to Light yellow |
| | Diethyl(4-bromophenyl)phosphonate Usage And Synthesis |
| | Diethyl(4-bromophenyl)phosphonate Preparation Products And Raw materials |
|