| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-beta-(R)-4-methoxyphenylalanine Basic information |
| Product Name: | Boc-beta-(R)-4-methoxyphenylalanine | | Synonyms: | (3R)-3-{[(tert-butoxy)carbonyl]amino}-3-(4-methoxyphenyl)propanoic acid;Boc-beta-(R)-4-methoxyphenylalanine;(R)-BOC-4-METHOXY-SS-PHE-OH;Boc-D-b-Phe(4-OMe)-OH;(R)-3-(Boc-amino)-3-(4-methoxyphenyl)propionic acid, Boc-β-Tyr(Me)-OH, Boc-4-methoxy-L-β-phenylalanine, Boc-O-methyl-L-β-tyrosine;BOC-(R)--(p-methoxyphenyl)alanine;(R)-Boc-4-methoxy-β-Phe-OH;Boc-4-Methoxy-D-b-phenylalanine | | CAS: | 500788-87-4 | | MF: | C15H21NO5 | | MW: | 295.33 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 500788-87-4.mol |  |
| | Boc-beta-(R)-4-methoxyphenylalanine Chemical Properties |
| Melting point | 107-108 °C | | Boiling point | 463.2±45.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.38±0.10(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO5/c1-15(2,3)21-14(19)16-12(9-13(17)18)10-5-7-11(20-4)8-6-10/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m1/s1 | | InChIKey | OPAAZWPTEYZZIW-GFCCVEGCSA-N | | SMILES | COc1ccc(cc1)[C@@H](CC(O)=O)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-beta-(R)-4-methoxyphenylalanine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-beta-(R)-4-methoxyphenylalanine Preparation Products And Raw materials |
|