| Company Name: |
ABBIOCHEM Gold |
| Tel: |
021-18964309092 18964309092 |
| Email: |
2769493375@qq.com |
|
| | 4-fluoro-7-methyl-1H-indole-2-carboxylic acid Basic information |
| | 4-fluoro-7-methyl-1H-indole-2-carboxylic acid Chemical Properties |
| Boiling point | 416.0±40.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 4.36±0.30(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C10H8FNO2/c1-5-2-3-7(11)6-4-8(10(13)14)12-9(5)6/h2-4,12H,1H3,(H,13,14) | | InChIKey | OVWFILNRMAXMMM-UHFFFAOYSA-N | | SMILES | N1C2=C(C(F)=CC=C2C)C=C1C(O)=O |
| | 4-fluoro-7-methyl-1H-indole-2-carboxylic acid Usage And Synthesis |
| | 4-fluoro-7-methyl-1H-indole-2-carboxylic acid Preparation Products And Raw materials |
|