Sodium 2,3,4,5-tetrafluorobenzoate manufacturers
|
| | Sodium 2,3,4,5-tetrafluorobenzoate Basic information |
| Product Name: | Sodium 2,3,4,5-tetrafluorobenzoate | | Synonyms: | 2,3,4,5-Tetrafluorobenzoic acid sodium salt;Sodium 2,3,4,5-Tetrafluorobenzoate Solution 20% aqueous solution;2,3,4,5-tetrafluorobenzenemacetic acidsodium | | CAS: | 67852-79-3 | | MF: | C7HF4O2.Na | | MW: | 216.0649 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 67852-79-3.mol |  |
| | Sodium 2,3,4,5-tetrafluorobenzoate Chemical Properties |
| Melting point | >280 °C | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Powder | | InChI | InChI=1S/C7H2F4O2.Na/c8-3-1-2(7(12)13)4(9)6(11)5(3)10;/h1H,(H,12,13);/q;+1/p-1 | | InChIKey | PVMKPXIEIWFYDX-UHFFFAOYSA-M | | SMILES | C1(C([O-])=O)=CC(=C(F)C(F)=C1F)F.[Na+] | | EPA Substance Registry System | Benzoic acid, 2,3,4,5-tetrafluoro-, sodium salt (1:1) (67852-79-3) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | TSCA | TSCA listed |
| | Sodium 2,3,4,5-tetrafluorobenzoate Usage And Synthesis |
| | Sodium 2,3,4,5-tetrafluorobenzoate Preparation Products And Raw materials |
|