|
|
| | 2,3,4,5-Tetrafluorobenzoic acid Basic information |
| Product Name: | 2,3,4,5-Tetrafluorobenzoic acid | | Synonyms: | 2,3,4,5-TETRAFLUOROBENZOIC ACID;2,3,4,5-TETRAFLUOROBENZOIC ACIDLEVOFLOXACIN;2,3,4,5-Tetrafluorobenzoic acid, 98+%;2,3,4,5-Tetrafluorobenzoic;2,3,4,5-Tetrafluorobenzoicacid,min.98%;2,3,4,5-Tetrafluorobenzoic acid 99%;2,3,4,5-TETRAFLUOROBEZOIC ACID;2,3,4,5-Tetrafluorobenzoicacid99% | | CAS: | 1201-31-6 | | MF: | C7H2F4O2 | | MW: | 194.08 | | EINECS: | 601-673-9 | | Product Categories: | Halogenated Heterocycles ,Pyrazoles;C7;Carbonyl Compounds;Carboxylic Acids;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;API intermediates;Miscellaneous;bc0001;OLED | | Mol File: | 1201-31-6.mol |  |
| | 2,3,4,5-Tetrafluorobenzoic acid Chemical Properties |
| Melting point | 85-87 °C (lit.) | | Boiling point | 135-137 °C(Press: 23 Torr) | | density | 1.5165 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.53±0.10(Predicted) | | form | Solid | | color | White | | BRN | 2052670 | | InChI | InChI=1S/C7H2F4O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13) | | InChIKey | SFKRXQKJTIYUAG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 1201-31-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2,3,4,5-tetrafluoro- (1201-31-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,4,5-Tetrafluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,3,4,5-Tetrafluorobenzoic Acid is used in the synthesis of diterpenoid analogs as antitumor compounds. Also used in the synthesis of novel quinoline lactones. |
| | 2,3,4,5-Tetrafluorobenzoic acid Preparation Products And Raw materials |
| Raw materials | Phthalic anhydride-->Tetrafluorophthalic acid | | Preparation Products | RUFLOXACIN-->Sparfloxacin-->Levofloxacin-->Ofloxacin-->2,3,4,5-TETRAFLUORO-6-NITROBENZOIC ACID-->Sparfloxacin-->1-BROMO-2,3,4,5-TETRAFLUOROBENZENE-->1-Cyclopropyl-6,7,8-trifluoro-1,4-dihydro-4-oxoq-->2,3,4,5-Tetrafluorobenzyl alcohol-->Ethyl 2,3,4,5-tetrafluorobenzoate-->1,2,3,4-Tetrafluorobenzene |
|