|
|
| | (R)-(+)-N-(1-PHENYLETHYL)PHTHALAMIC ACID Basic information |
| | (R)-(+)-N-(1-PHENYLETHYL)PHTHALAMIC ACID Chemical Properties |
| Melting point | 128-130 °C | | alpha | +46°(24℃, c=2, C2H5OH) | | Boiling point | 500.3±43.0 °C(Predicted) | | density | 1.222±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | pka | 3.48±0.36(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]24/D +46°, c = 2 in ethanol | | BRN | 5793588 | | InChI | 1S/C16H15NO3/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(19)20/h2-11H,1H3,(H,17,18)(H,19,20)/t11-/m1/s1 | | InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N | | SMILES | C[C@@H](NC(=O)c1ccccc1C(O)=O)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2924.29.7790 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-N-(1-PHENYLETHYL)PHTHALAMIC ACID Usage And Synthesis |
| Uses | Acid for the resolution of amines. |
| | (R)-(+)-N-(1-PHENYLETHYL)PHTHALAMIC ACID Preparation Products And Raw materials |
|