|
|
| | (R)-(+)-N-Acetyl-1-methylbenzylamine Basic information |
| | (R)-(+)-N-Acetyl-1-methylbenzylamine Chemical Properties |
| Melting point | 102-103 °C | | Boiling point | 290.31°C (rough estimate) | | density | 1.007 | | refractive index | 1.5400 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform, DMSO | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m1/s1 | | InChIKey | PAVMRYVMZLANOQ-MRVPVSSYSA-N | | SMILES | C(N[C@@H](C1=CC=CC=C1)C)(=O)C |
| Provider | Language |
|
ACROS
| English |
| | (R)-(+)-N-Acetyl-1-methylbenzylamine Usage And Synthesis |
| Chemical Properties | Beige crystalline powder | | Uses | N-[(R)-1-Phenylethyl]acetamide (cas# 36283-44-0) is a compound useful in organic synthesis. | | Definition | ChEBI: (R)-N-acetyl-1-phenylethylamine is an N-(1-phenylethyl)acetamide that has R configuration. It is functionally related to a (1R)-1-phenylethanamine. It is an enantiomer of a (S)-N-acetyl-1-phenylethylamine. |
| | (R)-(+)-N-Acetyl-1-methylbenzylamine Preparation Products And Raw materials |
|