| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | D-Mannose 6-phosphate monosodium salt Basic information |
| | D-Mannose 6-phosphate monosodium salt Chemical Properties |
| storage temp. | 2-8°C | | solubility | Methanol (Very Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | HUMECTANT SKIN CONDITIONING | | InChI | 1S/C6H13O9P.Na.H/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h1,3-6,8-11H,2H2,(H2,12,13,14);; | | InChIKey | RUFPTDNHMAGVMV-UHFFFAOYSA-N | | SMILES | [Na].OC(COP(O)(O)=O)C(O)C(O)C(O)C=O |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | D-Mannose 6-phosphate monosodium salt Usage And Synthesis |
| Uses | Mannose has been used in a study to assess in vivo targeting of alveolar macrophages. It has also been used in a study to investigate genetic engineering of the phosphocarrier protein NPr. |
| | D-Mannose 6-phosphate monosodium salt Preparation Products And Raw materials |
|