| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DL-Aspartic-2-13C-15N acid Basic information |
| | DL-Aspartic-2-13C-15N acid Chemical Properties |
| Melting point | >300 °C (dec.) (lit.) | | form | solid | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/i2+1,5+1 | | InChIKey | CKLJMWTZIZZHCS-BFQMUAMKSA-N | | SMILES | [15NH2][13CH](CC(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Aspartic-2-13C-15N acid Usage And Synthesis |
| Uses | DL-Aspartic acid-13C,15N is the 13C, and 15N-labeled DL-Aspartic acid. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-223. DOI:10.1080/02688697.2018.1500521 |
| | DL-Aspartic-2-13C-15N acid Preparation Products And Raw materials |
|