| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:AMMoniuM-15N acetate
CAS:86451-35-6
Purity:98 atoM % 15N Package:1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Ammonium-15N acetate
CAS:86451-35-6
Purity:98 atom % 15N Package:1G Remarks:363006-1G
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:AMMONIUM-15N ACETATE
CAS:86451-35-6
Purity:>=98 atom% 15N,>=98% Package:250mg Remarks:T33929
|
| Company Name: |
Shanghai wechem chemical co., ltd
|
| Tel: |
18824865657 |
| Email: |
2684615189@qq.com |
| Products Intro: |
Product Name:Ammonium-15N acetate
CAS:86451-35-6
Purity:99% HPLC Package:100g;500g;1kg
|
|
| | AMMONIUM-15N ACETATE Basic information |
| | AMMONIUM-15N ACETATE Chemical Properties |
| Melting point | 110-112 °C (dec.)(lit.) | | form | solid | | InChI | 1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i;1+1 | | InChIKey | USFZMSVCRYTOJT-IEOVAKBOSA-N | | SMILES | CC([O-])=O.[H][15N+]([H])([H])[H] | | CAS Number Unlabeled | 631-61-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AMMONIUM-15N ACETATE Usage And Synthesis |
| Uses | Ammonium-15N Acetate is 15N isotope labelled Ammonium Acetate (A633900), which is a versatile reagent, often used with acetic acid to create a buffer solution. It acts as a catalyst in the Knoevenagel condensation. Ammonium acetate is also used as a food additive as an acidity regulator. |
| | AMMONIUM-15N ACETATE Preparation Products And Raw materials |
|