|
|
| | Cyclohexylboronic acid pinacol ester Basic information |
| Product Name: | Cyclohexylboronic acid pinacol ester | | Synonyms: | CYCLOHEXYLBORONIC ACID ACID PINACOL ESTER;2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexane;1,3,2-Dioxaborolane, 2-cyclohexyl-4,4,5,5-tetraMethyl-;REF DUPL: Cyclohexylboronic acid pinacol ester;Cyclohexylboronic acid pinacol este;Cyclohexane acid pinacol ester;CYCLOHEXYLBORONIC ACID PINACOL ESTER | | CAS: | 87100-15-0 | | MF: | C12H23BO2 | | MW: | 210.12 | | EINECS: | | | Product Categories: | Alkyl;Organoborons | | Mol File: | 87100-15-0.mol |  |
| | Cyclohexylboronic acid pinacol ester Chemical Properties |
| Boiling point | 244.7±9.0 °C(Predicted) | | density | 0.93±0.1 g/cm3(Predicted) | | refractive index | 1.4460 to 1.4500 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Colorless | | InChI | InChI=1S/C12H23BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h10H,5-9H2,1-4H3 | | InChIKey | OUEVCDGYTKLNMJ-UHFFFAOYSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1C1CCCCC1 |
| | Cyclohexylboronic acid pinacol ester Usage And Synthesis |
| Uses | Cyclohexylboronic acid, pinacol ester | | Synthesis | The general procedure for the synthesis of 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane from pinacol and cyclohexylboronic acid is as follows: a mixture of cyclohexylboronic acid (1.0 eq.), pinacol (1.0 eq.), and anhydrous MgSO4 (4.0 eq.) in ethyl ether (Et2O, 0.5 M) was stirred for 16 h at room temperature. After completion of the reaction, the reaction mixture was filtered and the solvent was removed under vacuum. The crude product was purified by distillation or fast column chromatography to give pure 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. | | References | [1] Journal of the American Chemical Society, 2012, vol. 134, # 27, p. 11298 - 11298
[2] Synthesis (Germany), 2016, vol. 48, # 19, p. 3241 - 3253
[3] Journal of the American Chemical Society, 2018, vol. 140, # 44, p. 14677 - 14686
[4] Journal of the American Chemical Society, 2017, vol. 139, # 28, p. 9519 - 9522
[5] Synlett, 2018, vol. 29, # 8, p. 1092 - 1094 |
| | Cyclohexylboronic acid pinacol ester Preparation Products And Raw materials |
|