COENZYME Q2 manufacturers
- Coenzyme Q2
-
- $823.00 / 10mg
-
2026-05-11
- CAS:606-06-4
- Min. Order:
- Purity:
- Supply Ability: 10g
- COENZYME Q2
-
- $1000.00 / 1KG
-
2026-02-02
- CAS:606-06-4
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 2tons
|
| | COENZYME Q2 Basic information |
| Product Name: | COENZYME Q2 | | Synonyms: | 2,3-DIMETHOXY-5-METHYL-GERANYL-1,4-BENZOQUINONE;COENZYME Q2;2,3-dimethoxy-5-methyl-6-[poly0-2-methylbutenyl(2)]-1,4-quinone;2,3-dimethoxy-5-methyl-6-geranyl-1,4-benzoquinone;2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,6-dimethoxy-3-methyl-cyclohexa-2,5-diene-1,4-dione;Ubiquinone Q2;2,3-Dimethoxy-5-methyl-6-geranyl-1,4-benzoquinone, Ubiquinone-10;2,3-Dimethoxy-5-methyl-6-[(2E)-3,7-dimethyl-2,6-octadienyl]-1,4-benzoquinone | | CAS: | 606-06-4 | | MF: | C19H26O4 | | MW: | 318.41 | | EINECS: | 206-147-9 | | Product Categories: | | | Mol File: | 606-06-4.mol |  |
| | COENZYME Q2 Chemical Properties |
| Boiling point | 465.8±45.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 10 mg/ml; Ethanol: 10 mg/ml | | form | Red liquid. | | color | Colorless to light yellow | | Stability: | Stable, but light and heat sensitive. Store in the dark at -20 C. Incompatible with strong oxidizing agents. | | InChI | 1S/C19H26O4/c1-12(2)8-7-9-13(3)10-11-15-14(4)16(20)18(22-5)19(23-6)17(15)21/h8,10H,7,9,11H2,1-6H3/b13-10+ | | InChIKey | SQQWBSBBCSFQGC-JLHYYAGUSA-N | | SMILES | CC(C(C(OC)=C1OC)=O)=C(C/C=C(C)/CCC=C(C)C)C1=O |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | COENZYME Q2 Usage And Synthesis |
| Chemical Properties | solid | | Uses | Coenzyme Q2 is a redox carrier in the mitochondrial respiratory chain in eukaryotic cells. It has been used to investigate interaction of coenzyme Q with phosphatidylethanolamine membranes. | | Definition | ChEBI: A compound composed of the 2,3-dimethoxy-5-methylbenzoquinone nucleus common to ubiquinones; and a side chain of two isoprenoid units. | | Biochem/physiol Actions | Acts as an electron carrier and antioxidant in humans | | IC 50 | Human Endogenous Metabolite |
| | COENZYME Q2 Preparation Products And Raw materials |
|