| Company Name: |
GL Biochem (Shanghai) Ltd
|
| Tel: |
21-61263452 13641803416 |
| Email: |
ymbetter@glbiochem.com |
| Products Intro: |
Product Name:Fmoc-Ser(tBu)-Wang Resin
Purity:0.1~0.8mmol/g Package:10kg,1kg,500g,100g,25g
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:FMoc-Ser(tBu)-Wang resin (200-400 Mesh);FMoc-Ser(tBu)-p-alkoxybenzyl alcohol resin
Purity:99% Package:1.0g
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Products Intro: |
Product Name:Fmoc-Ser(tBu)-Wang resin
Package:1 g, 5 g Remarks:Resins for Peptide Synthesis
|
|
| | FMOC-SER(TBU)-WANG RESIN Basic information |
| | FMOC-SER(TBU)-WANG RESIN Chemical Properties |
| storage temp. | 2-8°C | | Major Application | peptide synthesis | | SMILES | [X]C(=O)[C@@H](NC(=O)OCC1c2c(cccc2)c3c1cccc3)COC(C)(C)C |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 21 | | Storage Class | 11 - Combustible Solids |
| | FMOC-SER(TBU)-WANG RESIN Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-SER(TBU)-WANG RESIN Preparation Products And Raw materials |
|