| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
- Fmoc-L-Ser-OH
-
-
2026-09-11
- CAS:73724-45-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-L-Serine
-
-
2026-09-11
- CAS:73724-45-5
- Min. Order: 1kg
- Purity: 98%min
- Supply Ability: 500kg
- Fmoc-L-Serine
-
-
2026-06-30
- CAS:73724-45-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | Fmoc-L-Serine Basic information |
| | Fmoc-L-Serine Chemical Properties |
| Melting point | 104-106°C | | Boiling point | 599.3±50.0 °C(Predicted) | | alpha | -12.5 º (c=1%, DMF) | | density | 1.362±0.06 g/cm3(Predicted) | | refractive index | -12.5 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.51±0.10(Predicted) | | color | White to Light yellow | | Optical Rotation | [α]20/D 12.5±1°, c = 1% in DMF | | BRN | 4715791 | | Major Application | peptide synthesis | | InChI | InChI=1S/C18H17NO5/c20-9-16(17(21)22)19-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16,20H,9-10H2,(H,19,23)(H,21,22)/t16-/m0/s1 | | InChIKey | JZTKZVJMSCONAK-INIZCTEOSA-N | | SMILES | C(O)(=O)[C@H](CO)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 73724-45-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-26 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-Serine Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | N-Fmoc-L-serine is an N-Fmoc-protected form of L-Serine (S270975). L-Serine is a nonessential amino acid that is required for the synthesis of sphingolipids and phosphatidylserine, compounds that are important for central nervous system neuronal survival. L-Serine is also important in intermediary metabolism in eukaryotic cells. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-Serine Preparation Products And Raw materials |
|