|
|
| | 3,3-DIMETHYLGLUTARIMIDE Basic information |
| Product Name: | 3,3-DIMETHYLGLUTARIMIDE | | Synonyms: | BETA-BETA-DIMETHYL GLUTARIMIDE;3,3-DIMETHYLGLUTARIMIDE;3,3-dimethyl-glutarimid;Glutarimide, 3,3-dimethyl-;3,3-Dimethylglutarimide,99%;3,3-DiMethylglutariMide, 99% 25GR;4,4-Dimethyl-2,6-dioxopiperidine;GEPI-004 | | CAS: | 1123-40-6 | | MF: | C7H11NO2 | | MW: | 141.17 | | EINECS: | 214-373-4 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Piperidines | | Mol File: | 1123-40-6.mol |  |
| | 3,3-DIMETHYLGLUTARIMIDE Chemical Properties |
| Melting point | 144-146 °C (lit.) | | Boiling point | 258.21°C (rough estimate) | | density | 1.1522 (rough estimate) | | refractive index | 1.5026 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 11.81±0.40(Predicted) | | color | White to Almost white | | Water Solubility | Soluble in water. | | BRN | 111981 | | InChI | InChI=1S/C7H11NO2/c1-7(2)3-5(9)8-6(10)4-7/h3-4H2,1-2H3,(H,8,9,10) | | InChIKey | YUJCWMGBRDBPDL-UHFFFAOYSA-N | | SMILES | N1C(=O)CC(C)(C)CC1=O | | CAS DataBase Reference | 1123-40-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2,6-Piperidinedione, 4,4-dimethyl-(1123-40-6) | | EPA Substance Registry System | 3,3-Dimethylglutarimide (1123-40-6) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 26-36/37-22 | | RIDADR | 2811 | | WGK Germany | 2 | | RTECS | MA4348000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29251995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 3,3-DIMETHYLGLUTARIMIDE Usage And Synthesis |
| Chemical Properties | white to white-grey crystalline powder | | Uses | 3,3'-dimethylglutarimide were used as the barbital subsitutes. 3,3-di-methyl-glutarimide is involved formation of the heterodimer. | | Purification Methods | Recrystallise the imide from hot H2O or EtOH [Arnett & Harrelson J Am Chem Soc 109 809 1987]. [Beilstein 21 H 391, 21 I 331, 21 II 309, 21 III/IV 4601, 21/9 V 592.] |
| | 3,3-DIMETHYLGLUTARIMIDE Preparation Products And Raw materials |
|