|
|
| | 4-Bromobenzylamine Basic information |
| | 4-Bromobenzylamine Chemical Properties |
| Melting point | 25 °C(lit.) | | Boiling point | 110-112 °C30 mm Hg(lit.) | | density | 1.473 g/mL at 25 °C(lit.) | | refractive index | 1.5855-1.5875 | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Liquid | | pka | 8.85±0.10(Predicted) | | color | Clear colorless | | InChI | InChI=1S/C7H8BrN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 | | InChIKey | XRNVSPDQTPVECU-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(Br)C=C1 | | CAS DataBase Reference | 3959-07-7(CAS DataBase Reference) | | NIST Chemistry Reference | p-Bromobenzylamine(3959-07-7) |
| Hazard Codes | C | | Risk Statements | 34-21/22 | | Safety Statements | 26-28-36/37/39-45 | | RIDADR | UN 3259 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅱ | | HS Code | 29214990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Bromobenzylamine Usage And Synthesis |
| Chemical Properties | clear colorless to light yellow liquid | | Uses | 4-Bromobenzylamine (p-Bromobenzylamine) may be used to synthesize 7-[(p-bromobenzyl)ureido]-7,8-dihydro-α-bisabolene. It may be used to synthesize the following 4-biphenylmethylamine derivatives:
- (4′-fluoro-4-biphenyl)methylamine
- (4′-methoxy-4-biphenyl)methylamine
- (2′-methoxy-4-biphenyl)methylamine
- (3′-cyano-4-biphenyl)methylamine
| | General Description | 4-Bromobenzylamine (BBA), also known as p-bromobenzylamine, is an aryl bromide. The selective formation of nitrile or imine from BBA in the presence of red copper has been reported. The formal [4+4] reaction of BBA to form 2,6,9-triazabicyclo[3.3.1]nonane derivatives has been investigated. |
| | 4-Bromobenzylamine Preparation Products And Raw materials |
|