| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3,5-Dimethylbenzyl alcohol manufacturers
|
| | 3,5-Dimethylbenzyl alcohol Basic information |
| Product Name: | 3,5-Dimethylbenzyl alcohol | | Synonyms: | 3,5-Dimethyl-1-hydroxymethylbenzene;Benzyl alcohol, 3,5-dimethyl-;RARECHEM AL BD 0341;3,5-Dimethylbenzylalcohol,99%;3,5-Dimethylbenzenemethanol;3,5-DiMethylbenzyl alcohol 98%;(3,5-Dimethylphenyl);3,5-DI METHYL BENZYL ALCHOL | | CAS: | 27129-87-9 | | MF: | C9H12O | | MW: | 136.19 | | EINECS: | 248-241-2 | | Product Categories: | Benzhydrols, Benzyl & Special Alcohols;Alcohols;C9 to C30;Oxygen Compounds | | Mol File: | 27129-87-9.mol |  |
| | 3,5-Dimethylbenzyl alcohol Chemical Properties |
| Boiling point | 218-221 °C (lit.) | | density | 0.927 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.531(lit.) | | Fp | 224 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 14+-.0.10(Predicted) | | Specific Gravity | 0.927 | | Appearance | Colorless to light yellow Liquid | | BRN | 2077285 | | Henry's Law Constant | 1.3×101 mol/(m3Pa) at 25℃, Wang et al. (2017) | | InChI | InChI=1S/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 | | InChIKey | IQWWTJDRVBWBEL-UHFFFAOYSA-N | | SMILES | C1(CO)=CC(C)=CC(C)=C1 | | LogP | 2.165 (est) | | CAS DataBase Reference | 27129-87-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 10 - Combustible liquids |
| | 3,5-Dimethylbenzyl alcohol Usage And Synthesis |
| Uses | 3,5-Dimethylbenzyl Alcohol is used in preparation of Aromatic Aldehyde. | | General Description | 3,5-Dimethylbenzyl alcohol undergoes linear polymerization to form 1,3,5,7-tetramethyl-9,10-dihydro-anthracene. |
| | 3,5-Dimethylbenzyl alcohol Preparation Products And Raw materials |
|