|
|
| | (2S)-(1-Tetrahydropyramid-2-one)-3-methylbutanoic acid Basic information |
| | (2S)-(1-Tetrahydropyramid-2-one)-3-methylbutanoic acid Chemical Properties |
| Melting point | 166-168oC | | Boiling point | 440.8±24.0 °C(Predicted) | | density | 1.176 | | vapor pressure | 0-0Pa at 20-25℃ | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.39±0.10(Predicted) | | color | White to Beige | | InChI | InChI=1/C9H16N2O3/c1-6(2)7(8(12)13)11-5-3-4-10-9(11)14/h6-7H,3-5H2,1-2H3,(H,10,14)(H,12,13)/t7-/s3 | | InChIKey | AFGBRTKUTJQHIP-KPOCXSGKNA-N | | SMILES | N1(CCCNC1=O)[C@@H](C(C)C)C(O)=O |&1:7,r| | | LogP | 0.17 at 21℃ | | Surface tension | 63.3-66.4mN/m at 100-1000mg/L and 20℃ | | CAS DataBase Reference | 192725-50-1(CAS DataBase Reference) |
| Risk Statements | 36 | | Safety Statements | 26 |
| | (2S)-(1-Tetrahydropyramid-2-one)-3-methylbutanoic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Lopinavir (L469480) intermediate. | | Uses | Anti-HIV drugs |
| | (2S)-(1-Tetrahydropyramid-2-one)-3-methylbutanoic acid Preparation Products And Raw materials |
|