|
|
| | [2-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenyl]boronic acid Basic information |
| | [2-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenyl]boronic acid Chemical Properties |
| Melting point | 146-149°C (dec.) | | Boiling point | 685.2±65.0 °C(Predicted) | | density | 1.20 | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly), Methanol (Slightly) | | pka | 7.97±0.58(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C26H21BN4O2/c32-27(33)24-19-11-10-18-23(24)25-28-30-31(29-25)26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19,32-33H | | InChIKey | LFUCLSFLKKJFQH-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC=C1C1=NN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=N1)(O)O |
| | [2-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenyl]boronic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An intermediate in the synthesis of Losartan |
| | [2-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenyl]boronic acid Preparation Products And Raw materials |
|