| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Chlorodimethylpentafluorophenylsilane Basic information |
| | Chlorodimethylpentafluorophenylsilane Chemical Properties |
| Melting point | 50-55 °C(lit.) | | Boiling point | 89 °C | | density | 1.384 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.448(lit.) | | Fp | 167 °F | | form | clear liquid | | Specific Gravity | 1.384 | | color | Colorless to Almost colorless | | Water Solubility | Reacts with water. | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | Sensitive | Moisture Sensitive | | BRN | 2858407 | | InChI | InChI=1S/C8H6ClF5Si/c1-15(2,9)8-6(13)4(11)3(10)5(12)7(8)14/h1-2H3 | | InChIKey | PQRFRTCWNCVQHI-UHFFFAOYSA-N | | SMILES | C1([Si](Cl)(C)C)=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 20082-71-7(CAS DataBase Reference) | | EPA Substance Registry System | Silane, chlorodimethyl(pentafluorophenyl)- (20082-71-7) |
| Hazard Codes | T,Xi,C,F | | Risk Statements | 34-37 | | Safety Statements | 36/37-45-36/37/39-26 | | RIDADR | UN 2987 8/PG 2 | | WGK Germany | 3 | | RTECS | XS9065000 | | F | 10-21 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 |
| | Chlorodimethylpentafluorophenylsilane Usage And Synthesis |
| Chemical Properties | clear colourless to light yellow liquid | | Uses | Pentafluorophenyldimethylchlorosilane is used in preparation of hydrophilic easy-to-clean coatings for kitchen appliance. | | Purification Methods | If it goes turbid on cooling due to separation of some LiCl, then dissolve it in Et2O, filter and fractionate it. [Morgan & Poole J Chromatogr 89 225 1974, Birkinshaw et al. J Chromatogr 132 548 1977.] |
| | Chlorodimethylpentafluorophenylsilane Preparation Products And Raw materials |
|