|
|
| | 2-(2-Chloroacetamido)-5-nitro-2'-chlorobenzophenone Basic information |
| Product Name: | 2-(2-Chloroacetamido)-5-nitro-2'-chlorobenzophenone | | Synonyms: | 2-Chloroacetylamido-5-nitro-2`-chlorobenzophenone;Clonazepam Impurity 3;2-Chloroacetylamido-5-Nitro-2'-Chlorobenzophenone (ClAc-CNAB);Clonazepam Impurity 9;Clonazepam Impurity 1;Clonazepam Impurity 1 (2-Chloro-N-(2-(2-Chlorobenzoyl)-4-Nitrophenyl)-Acetamide);Acetamide, 2-chloro-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]-;2-(2-chloroacetamido)-5-nitro-2'-chlorobenzophenone | | CAS: | 180854-85-7 | | MF: | C15H10Cl2N2O4 | | MW: | 353.16 | | EINECS: | | | Product Categories: | | | Mol File: | 180854-85-7.mol |  |
| | 2-(2-Chloroacetamido)-5-nitro-2'-chlorobenzophenone Chemical Properties |
| Boiling point | 607.8±55.0 °C(Predicted) | | density | 1.497±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Acetonitrile (Slightly), DMSO (Heated), Methanol (Slightly, Heated) | | pka | 10.96±0.70(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C15H10Cl2N2O4/c16-8-14(20)18-13-6-5-9(19(22)23)7-11(13)15(21)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,18,20) | | InChIKey | YBAJRIMWOFPRTG-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1Cl)(=O)CCl |
| | 2-(2-Chloroacetamido)-5-nitro-2'-chlorobenzophenone Usage And Synthesis |
| Uses | 2-Chloro-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide is a reactant in the synthesis of Clonazepam (C587080) which is an antiepileptic agent with anxiolytic and antimanic properties. |
| | 2-(2-Chloroacetamido)-5-nitro-2'-chlorobenzophenone Preparation Products And Raw materials |
|