|
|
| | 2-Amino-5-nitrobenzophenone Basic information |
| | 2-Amino-5-nitrobenzophenone Chemical Properties |
| Melting point | 166-168 °C (lit.) | | Boiling point | 385.05°C (rough estimate) | | density | 1.2480 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | -2.26±0.36(Predicted) | | color | Beige | | Water Solubility | 3 mg/L (20 C) | | InChI | InChI=1S/C13H10N2O3/c14-12-7-6-10(15(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,14H2 | | InChIKey | PZPZDEIASIKHPY-UHFFFAOYSA-N | | SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 1775-95-7(CAS DataBase Reference) | | NIST Chemistry Reference | Methanone, (2-amino-5-nitrophenyl)phenyl-(1775-95-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | RTECS | PC4935000 | | HS Code | 29223990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-5-nitrobenzophenone Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 2-Amino-5-nitrobenzophenone was used in the synthesis of [5-(4-nitrophenyl)-2-furyl]acrylic acid substituted benzophenone (anti-malarial agent). | | Uses | A metabolite of Nitrazepam | | Synthesis Reference(s) | Synthetic Communications, 16, p. 485, 1986 DOI: 10.1080/00397918608057727 | | General Description | FT-IR and Raman spectra of 2-amino-5-nitrobenzophenone (ANBP) has been reported. | | Synthesis | 2-Cyano-4-nitroaniline (0.3 mmol), sodium benzenesulfinate (0.6 mmol), palladium acetate (10 mol%), 2,2'-bipyridine (20 mol%), p-nitrobenzenesulfonic acid (10 equiv.), tetrahydrofuran (2 mL), and water (1 mL) were sequentially added to a Schlenk tube under the protection of nitrogen atmosphere. The reaction mixture was stirred vigorously at 80 °C for 48 hours. After completion of the reaction, the mixture was poured into ethyl acetate and washed sequentially with saturated sodium bicarbonate solution (2 x 10 mL) and saturated saline (1 x 10 mL). After the aqueous layer was extracted with ethyl acetate, all organic layers were combined and dried with anhydrous magnesium sulfate. The solvent was removed by concentration under reduced pressure and the residue was purified by fast column chromatography (eluent: hexane/ethyl acetate) to afford the target product 2-amino-5-nitrobenzophenone. | | References | [1] Molecules, 2014, vol. 19, # 5, p. 6439 - 6449 |
| | 2-Amino-5-nitrobenzophenone Preparation Products And Raw materials |
|