| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Naphthol as phosphate disodium salt Basic information |
| Product Name: | Naphthol as phosphate disodium salt | | Synonyms: | n-phenyl-3-(phosphonooxy)-2-naphthalenecarboxamiddisodiumsalt;naphthol as phosphate sodium;disodium N-phenyl-3-(phosphonooxy)-2-naphthalenecarboxamid;NAPHTHOL AS PHOSPHATE, DISODIUM SALT 97+%;N-Phenyl-3-[[bis(sodiooxy)phosphinyl]oxy]-2-naphthalenecarboxamide;Naphthol as phosphate disodium salt | | CAS: | 69815-54-9 | | MF: | C17H12NNa2O5P | | MW: | 387.23 | | EINECS: | | | Product Categories: | N;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 69815-54-9.mol |  |
| | Naphthol as phosphate disodium salt Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear, light yellow | | form | powder | | color | white to off-white | | Water Solubility | water: 50mg/mL, clear, light yellow | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C17H14NO5P.2Na/c19-17(18-14-8-2-1-3-9-14)15-10-12-6-4-5-7-13(12)11-16(15)23-24(20,21)22;;/h1-11H,(H,18,19)(H2,20,21,22);;/q;2*+1/p-2 | | InChIKey | APGJTCWWLWOMQM-UHFFFAOYSA-L | | SMILES | [Na+].[Na+].[O-]P([O-])(=O)Oc1cc2ccccc2cc1C(=O)Nc3ccccc3 | | EPA Substance Registry System | 2-Naphthalenecarboxamide, N-phenyl-3-(phosphonooxy)-, disodium salt (69815-54-9) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Naphthol as phosphate disodium salt Usage And Synthesis |
| Uses | Naphthol AS phosphate disodium salt is intended for use as a substrate for the histochemical demonstration of acid and alkaline phosphatase activities. |
| | Naphthol as phosphate disodium salt Preparation Products And Raw materials |
|